C13H15FN4OS — CID 115368097
2-fluoro-4-[[1-(2-methoxyethyl)pyrazol-4-yl]amino]benzenecarbothioamide (PubChem CID 115368097) has the molecular formula C13H15FN4OS and a molecular weight of 294.36 g/mol. Its IUPAC name is 2-fluoro-4-[[1-(2-methoxyethyl)pyrazol-4-yl]amino]benzenecarbothioamide.
| Compound Name | 2-fluoro-4-[[1-(2-methoxyethyl)pyrazol-4-yl]amino]benzenecarbothioamide |
|---|---|
| PubChem CID | 115368097 |
| Molecular Formula | C13H15FN4OS |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 2-fluoro-4-[[1-(2-methoxyethyl)pyrazol-4-yl]amino]benzenecarbothioamide |
| SMILES | COCCn1cc(Nc2ccc(C(N)=S)c(F)c2)cn1 |
| InChI | InChI=1S/C13H15FN4OS/c1-19-5-4-18-8-10(7-16-18)17-9-2-3-11(13(15)20)12(14)6-9/h2-3,6-8,17H,4-5H2,1H3,(H2,15,20) |
| InChIKey | MMWPDJOWHNQGJK-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|