C13H15BrN4OS — CID 82805280
3-bromo-4-[[1-(2-methoxyethyl)pyrazol-4-yl]amino]benzenecarbothioamide (PubChem CID 82805280) has the molecular formula C13H15BrN4OS and a molecular weight of 355.26 g/mol. Its IUPAC name is 3-bromo-4-[[1-(2-methoxyethyl)pyrazol-4-yl]amino]benzenecarbothioamide.
| Compound Name | 3-bromo-4-[[1-(2-methoxyethyl)pyrazol-4-yl]amino]benzenecarbothioamide |
|---|---|
| PubChem CID | 82805280 |
| Molecular Formula | C13H15BrN4OS |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | 3-bromo-4-[[1-(2-methoxyethyl)pyrazol-4-yl]amino]benzenecarbothioamide |
| SMILES | COCCn1cc(Nc2ccc(C(N)=S)cc2Br)cn1 |
| InChI | InChI=1S/C13H15BrN4OS/c1-19-5-4-18-8-10(7-16-18)17-12-3-2-9(13(15)20)6-11(12)14/h2-3,6-8,17H,4-5H2,1H3,(H2,15,20) |
| InChIKey | YZMGEWXJPFLHKW-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|