C11H13F2NOS — CID 82085774
3-(2,4-difluorophenoxy)-2,2-dimethylpropanethioamide (PubChem CID 82085774) has the molecular formula C11H13F2NOS and a molecular weight of 245.29 g/mol. Its IUPAC name is 3-(2,4-difluorophenoxy)-2,2-dimethylpropanethioamide.
| Compound Name | 3-(2,4-difluorophenoxy)-2,2-dimethylpropanethioamide |
|---|---|
| PubChem CID | 82085774 |
| Molecular Formula | C11H13F2NOS |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 3-(2,4-difluorophenoxy)-2,2-dimethylpropanethioamide |
| SMILES | CC(C)(COc1ccc(F)cc1F)C(N)=S |
| InChI | InChI=1S/C11H13F2NOS/c1-11(2,10(14)16)6-15-9-4-3-7(12)5-8(9)13/h3-5H,6H2,1-2H3,(H2,14,16) |
| InChIKey | SNZGXYVNTAXDCT-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|