C18H17NO8 — CID 168568312
5-[[4-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]phenoxy]methyl]furan-2-carboxylic acid (PubChem CID 168568312) has the molecular formula C18H17NO8 and a molecular weight of 375.33 g/mol. Its IUPAC name is 5-[[4-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]phenoxy]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[4-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]phenoxy]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 168568312 |
| Molecular Formula | C18H17NO8 |
| Molecular Weight | 375.33 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 5-[[4-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]phenoxy]methyl]furan-2-carboxylic acid |
| SMILES | COC(=O)/C=C(/Nc1ccc(OCc2ccc(C(=O)O)o2)cc1)C(=O)OC |
| InChI | InChI=1S/C18H17NO8/c1-24-16(20)9-14(18(23)25-2)19-11-3-5-12(6-4-11)26-10-13-7-8-15(27-13)17(21)22/h3-9,19H,10H2,1-2H3,(H,21,22)/b14-9+ |
| InChIKey | PIJLAYXBJHIEQN-NTEUORMPSA-N |
| XLogP | 2.20 |
| TPSA | 124.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.33 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|