C19H23N3O5 — CID 168567745
dimethyl (E)-2-[4-[(1-ethyl-3-methylpyrazol-4-yl)methoxy]anilino]but-2-enedioate (PubChem CID 168567745) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is dimethyl (E)-2-[4-[(1-ethyl-3-methylpyrazol-4-yl)methoxy]anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[4-[(1-ethyl-3-methylpyrazol-4-yl)methoxy]anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168567745 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | dimethyl (E)-2-[4-[(1-ethyl-3-methylpyrazol-4-yl)methoxy]anilino]but-2-enedioate |
| SMILES | CCn1cc(COc2ccc(N/C(=C/C(=O)OC)C(=O)OC)cc2)c(C)n1 |
| InChI | InChI=1S/C19H23N3O5/c1-5-22-11-14(13(2)21-22)12-27-16-8-6-15(7-9-16)20-17(19(24)26-4)10-18(23)25-3/h6-11,20H,5,12H2,1-4H3/b17-10+ |
| InChIKey | AEEDTIPUDPHWQX-LICLKQGHSA-N |
| XLogP | 2.43 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|