C18H26N2O5 — CID 168568093
dimethyl (E)-2-[4-[2-(diethylamino)ethoxy]anilino]but-2-enedioate (PubChem CID 168568093) has the molecular formula C18H26N2O5 and a molecular weight of 350.42 g/mol. Its IUPAC name is dimethyl (E)-2-[4-[2-(diethylamino)ethoxy]anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[4-[2-(diethylamino)ethoxy]anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168568093 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | dimethyl (E)-2-[4-[2-(diethylamino)ethoxy]anilino]but-2-enedioate |
| SMILES | CCN(CC)CCOc1ccc(N/C(=C/C(=O)OC)C(=O)OC)cc1 |
| InChI | InChI=1S/C18H26N2O5/c1-5-20(6-2)11-12-25-15-9-7-14(8-10-15)19-16(18(22)24-4)13-17(21)23-3/h7-10,13,19H,5-6,11-12H2,1-4H3/b16-13+ |
| InChIKey | LFLNTAHZVDRMOR-DTQAZKPQSA-N |
| XLogP | 2.05 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|