C16H22N2O5 — CID 42537291
methyl (E)-3-[4-(2-hydroxyethoxy)anilino]-4-oxo-4-(propan-2-ylamino)but-2-enoate (PubChem CID 42537291) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is methyl (E)-3-[4-(2-hydroxyethoxy)anilino]-4-oxo-4-(propan-2-ylamino)but-2-enoate.
| Compound Name | methyl (E)-3-[4-(2-hydroxyethoxy)anilino]-4-oxo-4-(propan-2-ylamino)but-2-enoate |
|---|---|
| PubChem CID | 42537291 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | methyl (E)-3-[4-(2-hydroxyethoxy)anilino]-4-oxo-4-(propan-2-ylamino)but-2-enoate |
| SMILES | COC(=O)/C=C(/Nc1ccc(OCCO)cc1)C(=O)NC(C)C |
| InChI | InChI=1S/C16H22N2O5/c1-11(2)17-16(21)14(10-15(20)22-3)18-12-4-6-13(7-5-12)23-9-8-19/h4-7,10-11,18-19H,8-9H2,1-3H3,(H,17,21)/b14-10+ |
| InChIKey | MRXWUYFZZKSQHT-GXDHUFHOSA-N |
| XLogP | 1.05 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|