C13H15FN2O3 — CID 16648095
methyl (Z)-4-(ethylamino)-3-(4-fluoroanilino)-4-oxobut-2-enoate (PubChem CID 16648095) has the molecular formula C13H15FN2O3 and a molecular weight of 266.27 g/mol. Its IUPAC name is methyl (Z)-4-(ethylamino)-3-(4-fluoroanilino)-4-oxobut-2-enoate.
| Compound Name | methyl (Z)-4-(ethylamino)-3-(4-fluoroanilino)-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 16648095 |
| Molecular Formula | C13H15FN2O3 |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | methyl (Z)-4-(ethylamino)-3-(4-fluoroanilino)-4-oxobut-2-enoate |
| SMILES | CCNC(=O)/C(=C/C(=O)OC)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C13H15FN2O3/c1-3-15-13(18)11(8-12(17)19-2)16-10-6-4-9(14)5-7-10/h4-8,16H,3H2,1-2H3,(H,15,18)/b11-8- |
| InChIKey | VKTROHZNWUUXGZ-FLIBITNWSA-N |
| XLogP | 1.43 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|