C19H30N2O3 — CID 111430502
N-[4-[2-(diethylamino)ethoxy]phenyl]-2-(1-hydroxycyclopentyl)acetamide (PubChem CID 111430502) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is N-[4-[2-(diethylamino)ethoxy]phenyl]-2-(1-hydroxycyclopentyl)acetamide.
| Compound Name | N-[4-[2-(diethylamino)ethoxy]phenyl]-2-(1-hydroxycyclopentyl)acetamide |
|---|---|
| PubChem CID | 111430502 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | N-[4-[2-(diethylamino)ethoxy]phenyl]-2-(1-hydroxycyclopentyl)acetamide |
| SMILES | CCN(CC)CCOc1ccc(NC(=O)CC2(O)CCCC2)cc1 |
| InChI | InChI=1S/C19H30N2O3/c1-3-21(4-2)13-14-24-17-9-7-16(8-10-17)20-18(22)15-19(23)11-5-6-12-19/h7-10,23H,3-6,11-15H2,1-2H3,(H,20,22) |
| InChIKey | WJRMCHSKTJYCRD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |