C19H19N3O7 — CID 46809191
[2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 4-ethoxy-3-nitrobenzoate (PubChem CID 46809191) has the molecular formula C19H19N3O7 and a molecular weight of 401.38 g/mol. Its IUPAC name is [2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 4-ethoxy-3-nitrobenzoate.
| Compound Name | [2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 4-ethoxy-3-nitrobenzoate |
|---|---|
| PubChem CID | 46809191 |
| Molecular Formula | C19H19N3O7 |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | [2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 4-ethoxy-3-nitrobenzoate |
| SMILES | CCOc1ccc(C(=O)OC(C(=O)NC(=O)NC)c2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H19N3O7/c1-3-28-15-10-9-13(11-14(15)22(26)27)18(24)29-16(12-7-5-4-6-8-12)17(23)21-19(25)20-2/h4-11,16H,3H2,1-2H3,(H2,20,21,23,25) |
| InChIKey | VJZFNXAJOCWVLF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|