C21H12Cl2N2O7 — CID 126187785
[(1S)-1-(4-chlorophenyl)-2-oxo-2-phenylethyl] 2-chloro-3,5-dinitrobenzoate (PubChem CID 126187785) has the molecular formula C21H12Cl2N2O7 and a molecular weight of 475.24 g/mol. Its IUPAC name is [(1S)-1-(4-chlorophenyl)-2-oxo-2-phenylethyl] 2-chloro-3,5-dinitrobenzoate.
| Compound Name | [(1S)-1-(4-chlorophenyl)-2-oxo-2-phenylethyl] 2-chloro-3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 126187785 |
| Molecular Formula | C21H12Cl2N2O7 |
| Molecular Weight | 475.24 g/mol |
| Exact Mass | 474.00 |
| IUPAC Name | [(1S)-1-(4-chlorophenyl)-2-oxo-2-phenylethyl] 2-chloro-3,5-dinitrobenzoate |
| SMILES | O=C(O[C@H](C(=O)c1ccccc1)c1ccc(Cl)cc1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C21H12Cl2N2O7/c22-14-8-6-13(7-9-14)20(19(26)12-4-2-1-3-5-12)32-21(27)16-10-15(24(28)29)11-17(18(16)23)25(30)31/h1-11,20H/t20-/m0/s1 |
| InChIKey | CLAUHTSOUHBMOK-FQEVSTJZSA-N |
| XLogP | 5.59 |
| TPSA | 129.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.24 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|