C25H21NO5 — CID 18285359
[1,2-bis(4-methylphenyl)-2-oxoethyl] (E)-3-(2-nitrophenyl)prop-2-enoate (PubChem CID 18285359) has the molecular formula C25H21NO5 and a molecular weight of 415.45 g/mol. Its IUPAC name is [1,2-bis(4-methylphenyl)-2-oxoethyl] (E)-3-(2-nitrophenyl)prop-2-enoate.
| Compound Name | [1,2-bis(4-methylphenyl)-2-oxoethyl] (E)-3-(2-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 18285359 |
| Molecular Formula | C25H21NO5 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | [1,2-bis(4-methylphenyl)-2-oxoethyl] (E)-3-(2-nitrophenyl)prop-2-enoate |
| SMILES | Cc1ccc(C(=O)C(OC(=O)/C=C/c2ccccc2[N+](=O)[O-])c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C25H21NO5/c1-17-7-11-20(12-8-17)24(28)25(21-13-9-18(2)10-14-21)31-23(27)16-15-19-5-3-4-6-22(19)26(29)30/h3-16,25H,1-2H3/b16-15+ |
| InChIKey | HFVPZINJSKWEJO-FOCLMDBBSA-N |
| XLogP | 5.39 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|