About 1-pyridin-4-ylethyl (E)-3-(2-nitrophenyl)prop-2-enoate
1-pyridin-4-ylethyl (E)-3-(2-nitrophenyl)prop-2-enoate (PubChem CID 56793354) has the molecular formula C16H14N2O4
and a molecular weight of 298.30 g/mol. Its IUPAC name is 1-pyridin-4-ylethyl (E)-3-(2-nitrophenyl)prop-2-enoate.
Molecular Properties
| Compound Name | 1-pyridin-4-ylethyl (E)-3-(2-nitrophenyl)prop-2-enoate |
| PubChem CID | 56793354 |
| Molecular Formula | C16H14N2O4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 1-pyridin-4-ylethyl (E)-3-(2-nitrophenyl)prop-2-enoate |
| SMILES | CC(OC(=O)/C=C/c1ccccc1[N+](=O)[O-])c1ccncc1 |
| InChI | InChI=1S/C16H14N2O4/c1-12(13-8-10-17-11-9-13)22-16(19)7-6-14-4-2-3-5-15(14)18(20)21/h2-12H,1H3/b7-6+ |
| InChIKey | BHQVWYHUJGOTMT-VOTSOKGWSA-N |
| XLogP | 3.31 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-pyridin-4-ylethyl (E)-3-(2-nitrophenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyridin-4-ylethyl (E)-3-(2-nitrophenyl)prop-2-enoate?
The IUPAC name of 1-pyridin-4-ylethyl (E)-3-(2-nitrophenyl)prop-2-enoate (CID 56793354) is 1-pyridin-4-ylethyl (E)-3-(2-nitrophenyl)prop-2-enoate.
What is the SMILES notation for 1-pyridin-4-ylethyl (E)-3-(2-nitrophenyl)prop-2-enoate?
The canonical SMILES for 1-pyridin-4-ylethyl (E)-3-(2-nitrophenyl)prop-2-enoate is CC(OC(=O)/C=C/c1ccccc1[N+](=O)[O-])c1ccncc1.
What is the InChIKey of 1-pyridin-4-ylethyl (E)-3-(2-nitrophenyl)prop-2-enoate?
The InChIKey is BHQVWYHUJGOTMT-VOTSOKGWSA-N. The full InChI is InChI=1S/C16H14N2O4/c1-12(13-8-10-17-11-9-13)22-16(19)7-6-14-4-2-3-5-15(14)18(20)21/h2-12H,1H3/b7-6+.
What are the key properties of 1-pyridin-4-ylethyl (E)-3-(2-nitrophenyl)prop-2-enoate?
1-pyridin-4-ylethyl (E)-3-(2-nitrophenyl)prop-2-enoate has a molecular weight of 298.30 g/mol, XLogP of 3.31, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyridin-4-ylethyl (E)-3-(2-nitrophenyl)prop-2-enoate is sourced from PubChem (CID 56793354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).