C24H21NO6 — CID 7889835
[(1R)-1,2-bis(4-methylphenyl)-2-oxoethyl] 2-(2-nitrophenoxy)acetate (PubChem CID 7889835) has the molecular formula C24H21NO6 and a molecular weight of 419.43 g/mol. Its IUPAC name is [(1R)-1,2-bis(4-methylphenyl)-2-oxoethyl] 2-(2-nitrophenoxy)acetate.
| Compound Name | [(1R)-1,2-bis(4-methylphenyl)-2-oxoethyl] 2-(2-nitrophenoxy)acetate |
|---|---|
| PubChem CID | 7889835 |
| Molecular Formula | C24H21NO6 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | [(1R)-1,2-bis(4-methylphenyl)-2-oxoethyl] 2-(2-nitrophenoxy)acetate |
| SMILES | Cc1ccc(C(=O)[C@H](OC(=O)COc2ccccc2[N+](=O)[O-])c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H21NO6/c1-16-7-11-18(12-8-16)23(27)24(19-13-9-17(2)10-14-19)31-22(26)15-30-21-6-4-3-5-20(21)25(28)29/h3-14,24H,15H2,1-2H3/t24-/m1/s1 |
| InChIKey | NRIQJWHOTSVFTR-XMMPIXPASA-N |
| XLogP | 4.76 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|