C21H17NO5S — CID 7860985
[(1R)-1,2-bis(4-methylphenyl)-2-oxoethyl] 5-nitrothiophene-2-carboxylate (PubChem CID 7860985) has the molecular formula C21H17NO5S and a molecular weight of 395.44 g/mol. Its IUPAC name is [(1R)-1,2-bis(4-methylphenyl)-2-oxoethyl] 5-nitrothiophene-2-carboxylate.
| Compound Name | [(1R)-1,2-bis(4-methylphenyl)-2-oxoethyl] 5-nitrothiophene-2-carboxylate |
|---|---|
| PubChem CID | 7860985 |
| Molecular Formula | C21H17NO5S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | [(1R)-1,2-bis(4-methylphenyl)-2-oxoethyl] 5-nitrothiophene-2-carboxylate |
| SMILES | Cc1ccc(C(=O)[C@H](OC(=O)c2ccc([N+](=O)[O-])s2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H17NO5S/c1-13-3-7-15(8-4-13)19(23)20(16-9-5-14(2)6-10-16)27-21(24)17-11-12-18(28-17)22(25)26/h3-12,20H,1-2H3/t20-/m1/s1 |
| InChIKey | CXEPIWDNKBHKLW-HXUWFJFHSA-N |
| XLogP | 5.05 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|