C23H22N2O3 — CID 7792455
[(1S)-2-oxo-1,2-diphenylethyl] (E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoate (PubChem CID 7792455) has the molecular formula C23H22N2O3 and a molecular weight of 374.44 g/mol. Its IUPAC name is [(1S)-2-oxo-1,2-diphenylethyl] (E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoate.
| Compound Name | [(1S)-2-oxo-1,2-diphenylethyl] (E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7792455 |
| Molecular Formula | C23H22N2O3 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | [(1S)-2-oxo-1,2-diphenylethyl] (E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoate |
| SMILES | Cc1nn(C)c(C)c1/C=C/C(=O)O[C@H](C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H22N2O3/c1-16-20(17(2)25(3)24-16)14-15-21(26)28-23(19-12-8-5-9-13-19)22(27)18-10-6-4-7-11-18/h4-15,23H,1-3H3/b15-14+/t23-/m0/s1 |
| InChIKey | HTNHWYHUJWNDMY-NSFRLNINSA-N |
| XLogP | 4.22 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|