About 1-chloropentyl (E)-3-(4-chlorophenyl)prop-2-enoate
1-chloropentyl (E)-3-(4-chlorophenyl)prop-2-enoate (PubChem CID 175440268) has the molecular formula C14H16Cl2O2
and a molecular weight of 287.19 g/mol. Its IUPAC name is 1-chloropentyl (E)-3-(4-chlorophenyl)prop-2-enoate.
Molecular Properties
| Compound Name | 1-chloropentyl (E)-3-(4-chlorophenyl)prop-2-enoate |
| PubChem CID | 175440268 |
| Molecular Formula | C14H16Cl2O2 |
| Molecular Weight | 287.19 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 1-chloropentyl (E)-3-(4-chlorophenyl)prop-2-enoate |
| SMILES | CCCCC(Cl)OC(=O)/C=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H16Cl2O2/c1-2-3-4-13(16)18-14(17)10-7-11-5-8-12(15)9-6-11/h5-10,13H,2-4H2,1H3/b10-7+ |
| InChIKey | KIIMAKFSNLOOAB-JXMROGBWSA-N |
| XLogP | 4.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.19 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-chloropentyl (E)-3-(4-chlorophenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloropentyl (E)-3-(4-chlorophenyl)prop-2-enoate?
The IUPAC name of 1-chloropentyl (E)-3-(4-chlorophenyl)prop-2-enoate (CID 175440268) is 1-chloropentyl (E)-3-(4-chlorophenyl)prop-2-enoate.
What is the SMILES notation for 1-chloropentyl (E)-3-(4-chlorophenyl)prop-2-enoate?
The canonical SMILES for 1-chloropentyl (E)-3-(4-chlorophenyl)prop-2-enoate is CCCCC(Cl)OC(=O)/C=C/c1ccc(Cl)cc1.
What is the InChIKey of 1-chloropentyl (E)-3-(4-chlorophenyl)prop-2-enoate?
The InChIKey is KIIMAKFSNLOOAB-JXMROGBWSA-N. The full InChI is InChI=1S/C14H16Cl2O2/c1-2-3-4-13(16)18-14(17)10-7-11-5-8-12(15)9-6-11/h5-10,13H,2-4H2,1H3/b10-7+.
What are the key properties of 1-chloropentyl (E)-3-(4-chlorophenyl)prop-2-enoate?
1-chloropentyl (E)-3-(4-chlorophenyl)prop-2-enoate has a molecular weight of 287.19 g/mol, XLogP of 4.65, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloropentyl (E)-3-(4-chlorophenyl)prop-2-enoate is sourced from PubChem (CID 175440268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).