C19H26O4 — CID 69305658
2-methylpropyl 2,2-dimethyl-3-[(E)-3-phenylprop-2-enoyl]oxybutanoate (PubChem CID 69305658) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is 2-methylpropyl 2,2-dimethyl-3-[(E)-3-phenylprop-2-enoyl]oxybutanoate.
| Compound Name | 2-methylpropyl 2,2-dimethyl-3-[(E)-3-phenylprop-2-enoyl]oxybutanoate |
|---|---|
| PubChem CID | 69305658 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 2-methylpropyl 2,2-dimethyl-3-[(E)-3-phenylprop-2-enoyl]oxybutanoate |
| SMILES | CC(C)COC(=O)C(C)(C)C(C)OC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C19H26O4/c1-14(2)13-22-18(21)19(4,5)15(3)23-17(20)12-11-16-9-7-6-8-10-16/h6-12,14-15H,13H2,1-5H3/b12-11+ |
| InChIKey | QBWXUYYMNGMHDU-VAWYXSNFSA-N |
| XLogP | 3.86 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|