C22H21ClN2O5 — CID 46805271
(9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoate (PubChem CID 46805271) has the molecular formula C22H21ClN2O5 and a molecular weight of 428.87 g/mol. Its IUPAC name is (9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoate.
| Compound Name | (9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 46805271 |
| Molecular Formula | C22H21ClN2O5 |
| Molecular Weight | 428.87 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | (9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoate |
| SMILES | CCOc1cc(/C=C/C(=O)OCc2cc(=O)n3cccc(C)c3n2)cc(Cl)c1OC |
| InChI | InChI=1S/C22H21ClN2O5/c1-4-29-18-11-15(10-17(23)21(18)28-3)7-8-20(27)30-13-16-12-19(26)25-9-5-6-14(2)22(25)24-16/h5-12H,4,13H2,1-3H3/b8-7+ |
| InChIKey | BPTQYILNUDNFIG-BQYQJAHWSA-N |
| XLogP | 3.82 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.87 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|