C22H22N2O6 — CID 7542701
(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate (PubChem CID 7542701) has the molecular formula C22H22N2O6 and a molecular weight of 410.43 g/mol. Its IUPAC name is (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate.
| Compound Name | (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7542701 |
| Molecular Formula | C22H22N2O6 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCc2cc(=O)n3cc(C)ccc3n2)cc(OC)c1OC |
| InChI | InChI=1S/C22H22N2O6/c1-14-5-7-19-23-16(11-20(25)24(19)12-14)13-30-21(26)8-6-15-9-17(27-2)22(29-4)18(10-15)28-3/h5-12H,13H2,1-4H3/b8-6+ |
| InChIKey | PEBKBQMNONLURE-SOFGYWHQSA-N |
| XLogP | 2.79 |
| TPSA | 88.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|