C19H14ClFN2O3 — CID 7736337
(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl (E)-3-(2-chloro-6-fluorophenyl)prop-2-enoate (PubChem CID 7736337) has the molecular formula C19H14ClFN2O3 and a molecular weight of 372.78 g/mol. Its IUPAC name is (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl (E)-3-(2-chloro-6-fluorophenyl)prop-2-enoate.
| Compound Name | (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl (E)-3-(2-chloro-6-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7736337 |
| Molecular Formula | C19H14ClFN2O3 |
| Molecular Weight | 372.78 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl (E)-3-(2-chloro-6-fluorophenyl)prop-2-enoate |
| SMILES | Cc1ccc2nc(COC(=O)/C=C/c3c(F)cccc3Cl)cc(=O)n2c1 |
| InChI | InChI=1S/C19H14ClFN2O3/c1-12-5-7-17-22-13(9-18(24)23(17)10-12)11-26-19(25)8-6-14-15(20)3-2-4-16(14)21/h2-10H,11H2,1H3/b8-6+ |
| InChIKey | PDTHOTJMVVIKAN-SOFGYWHQSA-N |
| XLogP | 3.55 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.78 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|