C23H20N2O4 — CID 51237236
(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl (E)-3-(2-ethyl-1-benzofuran-3-yl)prop-2-enoate (PubChem CID 51237236) has the molecular formula C23H20N2O4 and a molecular weight of 388.42 g/mol. Its IUPAC name is (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl (E)-3-(2-ethyl-1-benzofuran-3-yl)prop-2-enoate.
| Compound Name | (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl (E)-3-(2-ethyl-1-benzofuran-3-yl)prop-2-enoate |
|---|---|
| PubChem CID | 51237236 |
| Molecular Formula | C23H20N2O4 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl (E)-3-(2-ethyl-1-benzofuran-3-yl)prop-2-enoate |
| SMILES | CCc1oc2ccccc2c1/C=C/C(=O)OCc1cc(=O)n2cc(C)ccc2n1 |
| InChI | InChI=1S/C23H20N2O4/c1-3-19-18(17-6-4-5-7-20(17)29-19)9-11-23(27)28-14-16-12-22(26)25-13-15(2)8-10-21(25)24-16/h4-13H,3,14H2,1-2H3/b11-9+ |
| InChIKey | OYTKWSXKIDCWGJ-PKNBQFBNSA-N |
| XLogP | 4.07 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|