C19H15ClO2S2 — CID 7721548
(4-methylsulfanylphenyl)methyl (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate (PubChem CID 7721548) has the molecular formula C19H15ClO2S2 and a molecular weight of 374.91 g/mol. Its IUPAC name is (4-methylsulfanylphenyl)methyl (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate.
| Compound Name | (4-methylsulfanylphenyl)methyl (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7721548 |
| Molecular Formula | C19H15ClO2S2 |
| Molecular Weight | 374.91 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | (4-methylsulfanylphenyl)methyl (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate |
| SMILES | CSc1ccc(COC(=O)/C=C/c2sc3ccccc3c2Cl)cc1 |
| InChI | InChI=1S/C19H15ClO2S2/c1-23-14-8-6-13(7-9-14)12-22-18(21)11-10-17-19(20)15-4-2-3-5-16(15)24-17/h2-11H,12H2,1H3/b11-10+ |
| InChIKey | QKMICLQUDPNGIY-ZHACJKMWSA-N |
| XLogP | 6.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.91 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|