C24H21N3O3 — CID 7712928
[2-(2,3-dihydroindol-1-yl)-2-oxoethyl] (E)-3-[1-(2-cyanoethyl)indol-3-yl]prop-2-enoate (PubChem CID 7712928) has the molecular formula C24H21N3O3 and a molecular weight of 399.45 g/mol. Its IUPAC name is [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] (E)-3-[1-(2-cyanoethyl)indol-3-yl]prop-2-enoate.
| Compound Name | [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] (E)-3-[1-(2-cyanoethyl)indol-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 7712928 |
| Molecular Formula | C24H21N3O3 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] (E)-3-[1-(2-cyanoethyl)indol-3-yl]prop-2-enoate |
| SMILES | N#CCCn1cc(/C=C/C(=O)OCC(=O)N2CCc3ccccc32)c2ccccc21 |
| InChI | InChI=1S/C24H21N3O3/c25-13-5-14-26-16-19(20-7-2-4-9-22(20)26)10-11-24(29)30-17-23(28)27-15-12-18-6-1-3-8-21(18)27/h1-4,6-11,16H,5,12,14-15,17H2/b11-10+ |
| InChIKey | CQLVZPSIZNSXDY-ZHACJKMWSA-N |
| XLogP | 3.70 |
| TPSA | 75.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|