C22H18N4O2 — CID 7712856
imidazo[1,2-a]pyridin-2-ylmethyl (E)-3-[1-(2-cyanoethyl)indol-3-yl]prop-2-enoate (PubChem CID 7712856) has the molecular formula C22H18N4O2 and a molecular weight of 370.41 g/mol. Its IUPAC name is imidazo[1,2-a]pyridin-2-ylmethyl (E)-3-[1-(2-cyanoethyl)indol-3-yl]prop-2-enoate.
| Compound Name | imidazo[1,2-a]pyridin-2-ylmethyl (E)-3-[1-(2-cyanoethyl)indol-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 7712856 |
| Molecular Formula | C22H18N4O2 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | imidazo[1,2-a]pyridin-2-ylmethyl (E)-3-[1-(2-cyanoethyl)indol-3-yl]prop-2-enoate |
| SMILES | N#CCCn1cc(/C=C/C(=O)OCc2cn3ccccc3n2)c2ccccc21 |
| InChI | InChI=1S/C22H18N4O2/c23-11-5-13-25-14-17(19-6-1-2-7-20(19)25)9-10-22(27)28-16-18-15-26-12-4-3-8-21(26)24-18/h1-4,6-10,12,14-15H,5,13,16H2/b10-9+ |
| InChIKey | QYXVEAUSILYISL-MDZDMXLPSA-N |
| XLogP | 3.96 |
| TPSA | 72.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|