C24H22N6O2 — CID 86902684
3-(5-phenyltetrazol-2-yl)propyl (E)-3-[1-(2-cyanoethyl)indol-3-yl]prop-2-enoate (PubChem CID 86902684) has the molecular formula C24H22N6O2 and a molecular weight of 426.48 g/mol. Its IUPAC name is 3-(5-phenyltetrazol-2-yl)propyl (E)-3-[1-(2-cyanoethyl)indol-3-yl]prop-2-enoate.
| Compound Name | 3-(5-phenyltetrazol-2-yl)propyl (E)-3-[1-(2-cyanoethyl)indol-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 86902684 |
| Molecular Formula | C24H22N6O2 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 3-(5-phenyltetrazol-2-yl)propyl (E)-3-[1-(2-cyanoethyl)indol-3-yl]prop-2-enoate |
| SMILES | N#CCCn1cc(/C=C/C(=O)OCCCn2nnc(-c3ccccc3)n2)c2ccccc21 |
| InChI | InChI=1S/C24H22N6O2/c25-14-6-15-29-18-20(21-10-4-5-11-22(21)29)12-13-23(31)32-17-7-16-30-27-24(26-28-30)19-8-2-1-3-9-19/h1-5,8-13,18H,6-7,15-17H2/b13-12+ |
| InChIKey | UZMNOGOBSZERRR-OUKQBFOZSA-N |
| XLogP | 3.86 |
| TPSA | 98.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|