C21H19BrFNO5S — CID 46811217
[2-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)-2-oxoethyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate (PubChem CID 46811217) has the molecular formula C21H19BrFNO5S and a molecular weight of 496.35 g/mol. Its IUPAC name is [2-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)-2-oxoethyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate.
| Compound Name | [2-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)-2-oxoethyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 46811217 |
| Molecular Formula | C21H19BrFNO5S |
| Molecular Weight | 496.35 g/mol |
| Exact Mass | 495.02 |
| IUPAC Name | [2-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)-2-oxoethyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate |
| SMILES | CS(=O)(=O)N1CCCc2cc(C(=O)COC(=O)/C=C/c3cc(Br)ccc3F)ccc21 |
| InChI | InChI=1S/C21H19BrFNO5S/c1-30(27,28)24-10-2-3-15-11-16(4-8-19(15)24)20(25)13-29-21(26)9-5-14-12-17(22)6-7-18(14)23/h4-9,11-12H,2-3,10,13H2,1H3/b9-5+ |
| InChIKey | HQJKHBZTPRIQST-WEVVVXLNSA-N |
| XLogP | 3.74 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|