C21H20FNO5S — CID 8517688
[2-(1-ethylsulfonyl-2,3-dihydroindol-5-yl)-2-oxoethyl] (E)-3-(4-fluorophenyl)prop-2-enoate (PubChem CID 8517688) has the molecular formula C21H20FNO5S and a molecular weight of 417.46 g/mol. Its IUPAC name is [2-(1-ethylsulfonyl-2,3-dihydroindol-5-yl)-2-oxoethyl] (E)-3-(4-fluorophenyl)prop-2-enoate.
| Compound Name | [2-(1-ethylsulfonyl-2,3-dihydroindol-5-yl)-2-oxoethyl] (E)-3-(4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8517688 |
| Molecular Formula | C21H20FNO5S |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | [2-(1-ethylsulfonyl-2,3-dihydroindol-5-yl)-2-oxoethyl] (E)-3-(4-fluorophenyl)prop-2-enoate |
| SMILES | CCS(=O)(=O)N1CCc2cc(C(=O)COC(=O)/C=C/c3ccc(F)cc3)ccc21 |
| InChI | InChI=1S/C21H20FNO5S/c1-2-29(26,27)23-12-11-16-13-17(6-9-19(16)23)20(24)14-28-21(25)10-5-15-3-7-18(22)8-4-15/h3-10,13H,2,11-12,14H2,1H3/b10-5+ |
| InChIKey | AZRYXUUZUGWQMM-BJMVGYQFSA-N |
| XLogP | 2.98 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|