C22H24N2O6S — CID 55373885
[2-(1-ethylsulfonyl-2,3-dihydroindol-5-yl)-2-oxoethyl] 2-benzamidopropanoate (PubChem CID 55373885) has the molecular formula C22H24N2O6S and a molecular weight of 444.51 g/mol. Its IUPAC name is [2-(1-ethylsulfonyl-2,3-dihydroindol-5-yl)-2-oxoethyl] 2-benzamidopropanoate.
| Compound Name | [2-(1-ethylsulfonyl-2,3-dihydroindol-5-yl)-2-oxoethyl] 2-benzamidopropanoate |
|---|---|
| PubChem CID | 55373885 |
| Molecular Formula | C22H24N2O6S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | [2-(1-ethylsulfonyl-2,3-dihydroindol-5-yl)-2-oxoethyl] 2-benzamidopropanoate |
| SMILES | CCS(=O)(=O)N1CCc2cc(C(=O)COC(=O)C(C)NC(=O)c3ccccc3)ccc21 |
| InChI | InChI=1S/C22H24N2O6S/c1-3-31(28,29)24-12-11-17-13-18(9-10-19(17)24)20(25)14-30-22(27)15(2)23-21(26)16-7-5-4-6-8-16/h4-10,13,15H,3,11-12,14H2,1-2H3,(H,23,26) |
| InChIKey | YGLAQWYGHGFDFL-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |