C20H17NO3S — CID 7793722
(2-phenyl-1,3-thiazol-4-yl)methyl (E)-3-(3-methoxyphenyl)prop-2-enoate (PubChem CID 7793722) has the molecular formula C20H17NO3S and a molecular weight of 351.43 g/mol. Its IUPAC name is (2-phenyl-1,3-thiazol-4-yl)methyl (E)-3-(3-methoxyphenyl)prop-2-enoate.
| Compound Name | (2-phenyl-1,3-thiazol-4-yl)methyl (E)-3-(3-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7793722 |
| Molecular Formula | C20H17NO3S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | (2-phenyl-1,3-thiazol-4-yl)methyl (E)-3-(3-methoxyphenyl)prop-2-enoate |
| SMILES | COc1cccc(/C=C/C(=O)OCc2csc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C20H17NO3S/c1-23-18-9-5-6-15(12-18)10-11-19(22)24-13-17-14-25-20(21-17)16-7-3-2-4-8-16/h2-12,14H,13H2,1H3/b11-10+ |
| InChIKey | DNGDWIKUBACEMO-ZHACJKMWSA-N |
| XLogP | 4.58 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|