C18H13NO4 — CID 684408
phenacyl 2-oxo-1H-quinoline-4-carboxylate (PubChem CID 684408) has the molecular formula C18H13NO4 and a molecular weight of 307.31 g/mol. Its IUPAC name is phenacyl 2-oxo-1H-quinoline-4-carboxylate.
| Compound Name | phenacyl 2-oxo-1H-quinoline-4-carboxylate |
|---|---|
| PubChem CID | 684408 |
| Molecular Formula | C18H13NO4 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | phenacyl 2-oxo-1H-quinoline-4-carboxylate |
| SMILES | O=C(COC(=O)c1cc(=O)[nH]c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C18H13NO4/c20-16(12-6-2-1-3-7-12)11-23-18(22)14-10-17(21)19-15-9-5-4-8-13(14)15/h1-10H,11H2,(H,19,21) |
| InChIKey | YOSKSJIHVRDSKA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |