C18H22N2O6 — CID 2435886
[2-[bis(2-methoxyethyl)amino]-2-oxoethyl] 2-oxo-1H-quinoline-4-carboxylate (PubChem CID 2435886) has the molecular formula C18H22N2O6 and a molecular weight of 362.38 g/mol. Its IUPAC name is [2-[bis(2-methoxyethyl)amino]-2-oxoethyl] 2-oxo-1H-quinoline-4-carboxylate.
| Compound Name | [2-[bis(2-methoxyethyl)amino]-2-oxoethyl] 2-oxo-1H-quinoline-4-carboxylate |
|---|---|
| PubChem CID | 2435886 |
| Molecular Formula | C18H22N2O6 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | [2-[bis(2-methoxyethyl)amino]-2-oxoethyl] 2-oxo-1H-quinoline-4-carboxylate |
| SMILES | COCCN(CCOC)C(=O)COC(=O)c1cc(=O)[nH]c2ccccc12 |
| InChI | InChI=1S/C18H22N2O6/c1-24-9-7-20(8-10-25-2)17(22)12-26-18(23)14-11-16(21)19-15-6-4-3-5-13(14)15/h3-6,11H,7-10,12H2,1-2H3,(H,19,21) |
| InChIKey | PBMPYEZCVDQZJL-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 97.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |