C17H18N2O4 — CID 2646060
(2-oxo-2-piperidin-1-ylethyl) 2-oxo-1H-quinoline-4-carboxylate (PubChem CID 2646060) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is (2-oxo-2-piperidin-1-ylethyl) 2-oxo-1H-quinoline-4-carboxylate.
| Compound Name | (2-oxo-2-piperidin-1-ylethyl) 2-oxo-1H-quinoline-4-carboxylate |
|---|---|
| PubChem CID | 2646060 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | (2-oxo-2-piperidin-1-ylethyl) 2-oxo-1H-quinoline-4-carboxylate |
| SMILES | O=C(OCC(=O)N1CCCCC1)c1cc(=O)[nH]c2ccccc12 |
| InChI | InChI=1S/C17H18N2O4/c20-15-10-13(12-6-2-3-7-14(12)18-15)17(22)23-11-16(21)19-8-4-1-5-9-19/h2-3,6-7,10H,1,4-5,8-9,11H2,(H,18,20) |
| InChIKey | DBXJYPXLNNTPBJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |