C21H22N2O5 — CID 9355323
3-(2,4-dimethoxyphenyl)-5-[(2-methoxy-4-prop-2-enylphenoxy)methyl]-1,2,4-oxadiazole (PubChem CID 9355323) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-5-[(2-methoxy-4-prop-2-enylphenoxy)methyl]-1,2,4-oxadiazole.
| Compound Name | 3-(2,4-dimethoxyphenyl)-5-[(2-methoxy-4-prop-2-enylphenoxy)methyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 9355323 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)-5-[(2-methoxy-4-prop-2-enylphenoxy)methyl]-1,2,4-oxadiazole |
| SMILES | C=CCc1ccc(OCc2nc(-c3ccc(OC)cc3OC)no2)c(OC)c1 |
| InChI | InChI=1S/C21H22N2O5/c1-5-6-14-7-10-17(19(11-14)26-4)27-13-20-22-21(23-28-20)16-9-8-15(24-2)12-18(16)25-3/h5,7-12H,1,6,13H2,2-4H3 |
| InChIKey | AWQUFUMOZXKLBY-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 75.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|