C30H36N2O6 — CID 53494675
2-(1H-indol-3-yl)-N,N-bis[(2,4,5-trimethoxyphenyl)methyl]ethanamine (PubChem CID 53494675) has the molecular formula C30H36N2O6 and a molecular weight of 520.63 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-N,N-bis[(2,4,5-trimethoxyphenyl)methyl]ethanamine.
| Compound Name | 2-(1H-indol-3-yl)-N,N-bis[(2,4,5-trimethoxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 53494675 |
| Molecular Formula | C30H36N2O6 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | 2-(1H-indol-3-yl)-N,N-bis[(2,4,5-trimethoxyphenyl)methyl]ethanamine |
| SMILES | COc1cc(OC)c(OC)cc1CN(CCc1c[nH]c2ccccc12)Cc1cc(OC)c(OC)cc1OC |
| InChI | InChI=1S/C30H36N2O6/c1-33-25-15-29(37-5)27(35-3)13-21(25)18-32(12-11-20-17-31-24-10-8-7-9-23(20)24)19-22-14-28(36-4)30(38-6)16-26(22)34-2/h7-10,13-17,31H,11-12,18-19H2,1-6H3 |
| InChIKey | GIVBMSWNWFIWSV-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 74.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |