C21H20ClNO4 — CID 7541687
(6-chloro-4H-1,3-benzodioxin-8-yl)methyl 4-(1H-indol-3-yl)butanoate (PubChem CID 7541687) has the molecular formula C21H20ClNO4 and a molecular weight of 385.85 g/mol. Its IUPAC name is (6-chloro-4H-1,3-benzodioxin-8-yl)methyl 4-(1H-indol-3-yl)butanoate.
| Compound Name | (6-chloro-4H-1,3-benzodioxin-8-yl)methyl 4-(1H-indol-3-yl)butanoate |
|---|---|
| PubChem CID | 7541687 |
| Molecular Formula | C21H20ClNO4 |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | (6-chloro-4H-1,3-benzodioxin-8-yl)methyl 4-(1H-indol-3-yl)butanoate |
| SMILES | O=C(CCCc1c[nH]c2ccccc12)OCc1cc(Cl)cc2c1OCOC2 |
| InChI | InChI=1S/C21H20ClNO4/c22-17-8-15-11-25-13-27-21(15)16(9-17)12-26-20(24)7-3-4-14-10-23-19-6-2-1-5-18(14)19/h1-2,5-6,8-10,23H,3-4,7,11-13H2 |
| InChIKey | YLATZJZOBCLFNE-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 60.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |