C23H23ClN4O2 — CID 127028536
1-[4-(6-chloro-1,2-benzoxazol-3-yl)piperazin-1-yl]-4-(1H-indol-3-yl)butan-1-one (PubChem CID 127028536) has the molecular formula C23H23ClN4O2 and a molecular weight of 422.92 g/mol. Its IUPAC name is 1-[4-(6-chloro-1,2-benzoxazol-3-yl)piperazin-1-yl]-4-(1H-indol-3-yl)butan-1-one.
| Compound Name | 1-[4-(6-chloro-1,2-benzoxazol-3-yl)piperazin-1-yl]-4-(1H-indol-3-yl)butan-1-one |
|---|---|
| PubChem CID | 127028536 |
| Molecular Formula | C23H23ClN4O2 |
| Molecular Weight | 422.92 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 1-[4-(6-chloro-1,2-benzoxazol-3-yl)piperazin-1-yl]-4-(1H-indol-3-yl)butan-1-one |
| SMILES | O=C(CCCc1c[nH]c2ccccc12)N1CCN(c2noc3cc(Cl)ccc23)CC1 |
| InChI | InChI=1S/C23H23ClN4O2/c24-17-8-9-19-21(14-17)30-26-23(19)28-12-10-27(11-13-28)22(29)7-3-4-16-15-25-20-6-2-1-5-18(16)20/h1-2,5-6,8-9,14-15,25H,3-4,7,10-13H2 |
| InChIKey | JNVVCEHCXUDPRL-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 65.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.92 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |