C22H23ClN4O3 — CID 26660355
1-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-4-(1H-indol-3-yl)butan-1-one (PubChem CID 26660355) has the molecular formula C22H23ClN4O3 and a molecular weight of 426.90 g/mol. Its IUPAC name is 1-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-4-(1H-indol-3-yl)butan-1-one.
| Compound Name | 1-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-4-(1H-indol-3-yl)butan-1-one |
|---|---|
| PubChem CID | 26660355 |
| Molecular Formula | C22H23ClN4O3 |
| Molecular Weight | 426.90 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 1-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-4-(1H-indol-3-yl)butan-1-one |
| SMILES | O=C(CCCc1c[nH]c2ccccc12)N1CCN(c2ccc(Cl)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C22H23ClN4O3/c23-17-8-9-20(21(14-17)27(29)30)25-10-12-26(13-11-25)22(28)7-3-4-16-15-24-19-6-2-1-5-18(16)19/h1-2,5-6,8-9,14-15,24H,3-4,7,10-13H2 |
| InChIKey | CGXAGYKNKQLICE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 82.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.90 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|