C19H17ClN4O4 — CID 27808810
2-(1,2-benzoxazol-3-yl)-1-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]ethanone (PubChem CID 27808810) has the molecular formula C19H17ClN4O4 and a molecular weight of 400.82 g/mol. Its IUPAC name is 2-(1,2-benzoxazol-3-yl)-1-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(1,2-benzoxazol-3-yl)-1-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 27808810 |
| Molecular Formula | C19H17ClN4O4 |
| Molecular Weight | 400.82 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 2-(1,2-benzoxazol-3-yl)-1-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]ethanone |
| SMILES | O=C(Cc1noc2ccccc12)N1CCN(c2ccc(Cl)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C19H17ClN4O4/c20-13-5-6-16(17(11-13)24(26)27)22-7-9-23(10-8-22)19(25)12-15-14-3-1-2-4-18(14)28-21-15/h1-6,11H,7-10,12H2 |
| InChIKey | REXAQMXIXNNWBZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 92.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.82 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|