C36H41ClF2N4O2 — CID 67856502
3-(4-chlorobutyl)-5-fluoro-1H-indole;3-[4-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]butyl]-5-fluoro-1H-indole (PubChem CID 67856502) has the molecular formula C36H41ClF2N4O2 and a molecular weight of 635.20 g/mol. Its IUPAC name is 3-(4-chlorobutyl)-5-fluoro-1H-indole;3-[4-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]butyl]-5-fluoro-1H-indole.
| Compound Name | 3-(4-chlorobutyl)-5-fluoro-1H-indole;3-[4-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]butyl]-5-fluoro-1H-indole |
|---|---|
| PubChem CID | 67856502 |
| Molecular Formula | C36H41ClF2N4O2 |
| Molecular Weight | 635.20 g/mol |
| Exact Mass | 634.29 |
| IUPAC Name | 3-(4-chlorobutyl)-5-fluoro-1H-indole;3-[4-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]butyl]-5-fluoro-1H-indole |
| SMILES | Fc1ccc2[nH]cc(CCCCCl)c2c1.Fc1ccc2[nH]cc(CCCCN3CCN(c4ccc5c(c4)OCCO5)CC3)c2c1 |
| InChI | InChI=1S/C24H28FN3O2.C12H13ClFN/c25-19-4-6-22-21(15-19)18(17-26-22)3-1-2-8-27-9-11-28(12-10-27)20-5-7-23-24(16-20)30-14-13-29-23;13-6-2-1-3-9-8-15-12-5-4-10(14)7-11(9)12/h4-7,15-17,26H,1-3,8-14H2;4-5,7-8,15H,1-3,6H2 |
| InChIKey | IRUNCDLFTBCEIS-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 56.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.20 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|