C36H37ClN6O2 — CID 67856496
3-(3-chloropropyl)-1H-indole-6-carbonitrile;3-[3-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]propyl]-1H-indole-6-carbonitrile (PubChem CID 67856496) has the molecular formula C36H37ClN6O2 and a molecular weight of 621.19 g/mol. Its IUPAC name is 3-(3-chloropropyl)-1H-indole-6-carbonitrile;3-[3-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]propyl]-1H-indole-6-carbonitrile.
| Compound Name | 3-(3-chloropropyl)-1H-indole-6-carbonitrile;3-[3-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]propyl]-1H-indole-6-carbonitrile |
|---|---|
| PubChem CID | 67856496 |
| Molecular Formula | C36H37ClN6O2 |
| Molecular Weight | 621.19 g/mol |
| Exact Mass | 620.27 |
| IUPAC Name | 3-(3-chloropropyl)-1H-indole-6-carbonitrile;3-[3-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]propyl]-1H-indole-6-carbonitrile |
| SMILES | N#Cc1ccc2c(CCCCl)c[nH]c2c1.N#Cc1ccc2c(CCCN3CCN(c4ccc5c(c4)OCCO5)CC3)c[nH]c2c1 |
| InChI | InChI=1S/C24H26N4O2.C12H11ClN2/c25-16-18-3-5-21-19(17-26-22(21)14-18)2-1-7-27-8-10-28(11-9-27)20-4-6-23-24(15-20)30-13-12-29-23;13-5-1-2-10-8-15-12-6-9(7-14)3-4-11(10)12/h3-6,14-15,17,26H,1-2,7-13H2;3-4,6,8,15H,1-2,5H2 |
| InChIKey | VYCHSNSGFCXYIX-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 104.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.19 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|