C27H31ClN6O3 — CID 141371465
3-[4-[4-(2-benzofuran-5-yl)piperazin-1-yl]butyl]-1H-indole-5-carbonitrile;oxamide;hydrochloride (PubChem CID 141371465) has the molecular formula C27H31ClN6O3 and a molecular weight of 523.04 g/mol. Its IUPAC name is 3-[4-[4-(2-benzofuran-5-yl)piperazin-1-yl]butyl]-1H-indole-5-carbonitrile;oxamide;hydrochloride.
| Compound Name | 3-[4-[4-(2-benzofuran-5-yl)piperazin-1-yl]butyl]-1H-indole-5-carbonitrile;oxamide;hydrochloride |
|---|---|
| PubChem CID | 141371465 |
| Molecular Formula | C27H31ClN6O3 |
| Molecular Weight | 523.04 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | 3-[4-[4-(2-benzofuran-5-yl)piperazin-1-yl]butyl]-1H-indole-5-carbonitrile;oxamide;hydrochloride |
| SMILES | Cl.N#Cc1ccc2[nH]cc(CCCCN3CCN(c4ccc5cocc5c4)CC3)c2c1.NC(=O)C(N)=O |
| InChI | InChI=1S/C25H26N4O.C2H4N2O2.ClH/c26-15-19-4-7-25-24(13-19)20(16-27-25)3-1-2-8-28-9-11-29(12-10-28)23-6-5-21-17-30-18-22(21)14-23;3-1(5)2(4)6;/h4-7,13-14,16-18,27H,1-3,8-12H2;(H2,3,5)(H2,4,6);1H |
| InChIKey | YSUAZOXVMQAHOX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 145.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.04 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|