C34H35N5O2 — CID 69419961
5-[4-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-1-yl]-N-(2-phenylethyl)-1-benzofuran-2-carboxamide (PubChem CID 69419961) has the molecular formula C34H35N5O2 and a molecular weight of 545.69 g/mol. Its IUPAC name is 5-[4-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-1-yl]-N-(2-phenylethyl)-1-benzofuran-2-carboxamide.
| Compound Name | 5-[4-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-1-yl]-N-(2-phenylethyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 69419961 |
| Molecular Formula | C34H35N5O2 |
| Molecular Weight | 545.69 g/mol |
| Exact Mass | 545.28 |
| IUPAC Name | 5-[4-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-1-yl]-N-(2-phenylethyl)-1-benzofuran-2-carboxamide |
| SMILES | N#Cc1ccc2[nH]cc(CCCCN3CCN(c4ccc5oc(C(=O)NCCc6ccccc6)cc5c4)CC3)c2c1 |
| InChI | InChI=1S/C34H35N5O2/c35-23-26-9-11-31-30(20-26)27(24-37-31)8-4-5-15-38-16-18-39(19-17-38)29-10-12-32-28(21-29)22-33(41-32)34(40)36-14-13-25-6-2-1-3-7-25/h1-3,6-7,9-12,20-22,24,37H,4-5,8,13-19H2,(H,36,40) |
| InChIKey | YTBWGQGFKDWYJP-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 88.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.69 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|