C41H43ClN6O3 — CID 159793693
3-(4-chlorobutyl)-5-isocyano-1H-indole;ethyl 5-[4-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-1-yl]-1-benzofuran-2-carboxylate (PubChem CID 159793693) has the molecular formula C41H43ClN6O3 and a molecular weight of 703.29 g/mol. Its IUPAC name is 3-(4-chlorobutyl)-5-isocyano-1H-indole;ethyl 5-[4-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-1-yl]-1-benzofuran-2-carboxylate.
| Compound Name | 3-(4-chlorobutyl)-5-isocyano-1H-indole;ethyl 5-[4-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-1-yl]-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 159793693 |
| Molecular Formula | C41H43ClN6O3 |
| Molecular Weight | 703.29 g/mol |
| Exact Mass | 702.31 |
| IUPAC Name | 3-(4-chlorobutyl)-5-isocyano-1H-indole;ethyl 5-[4-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-1-yl]-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(N3CCN(CCCCc4c[nH]c5ccc(C#N)cc45)CC3)ccc2o1.[C-]#[N+]c1ccc2[nH]cc(CCCCCl)c2c1 |
| InChI | InChI=1S/C28H30N4O3.C13H13ClN2/c1-2-34-28(33)27-17-22-16-23(7-9-26(22)35-27)32-13-11-31(12-14-32)10-4-3-5-21-19-30-25-8-6-20(18-29)15-24(21)25;1-15-11-5-6-13-12(8-11)10(9-16-13)4-2-3-7-14/h6-9,15-17,19,30H,2-5,10-14H2,1H3;5-6,8-9,16H,2-4,7H2 |
| InChIKey | NIWXJSSTBSFKST-UHFFFAOYSA-N |
| XLogP | 9.39 |
| TPSA | 105.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.29 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|