C28H30N4O3 — CID 123220745
ethyl 5-[4-[4-(5-isocyano-1H-indol-3-yl)butyl]piperazin-1-yl]-1-benzofuran-2-carboxylate (PubChem CID 123220745) has the molecular formula C28H30N4O3 and a molecular weight of 470.57 g/mol. Its IUPAC name is ethyl 5-[4-[4-(5-isocyano-1H-indol-3-yl)butyl]piperazin-1-yl]-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 5-[4-[4-(5-isocyano-1H-indol-3-yl)butyl]piperazin-1-yl]-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 123220745 |
| Molecular Formula | C28H30N4O3 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | ethyl 5-[4-[4-(5-isocyano-1H-indol-3-yl)butyl]piperazin-1-yl]-1-benzofuran-2-carboxylate |
| SMILES | [C-]#[N+]c1ccc2[nH]cc(CCCCN3CCN(c4ccc5oc(C(=O)OCC)cc5c4)CC3)c2c1 |
| InChI | InChI=1S/C28H30N4O3/c1-3-34-28(33)27-17-21-16-23(8-10-26(21)35-27)32-14-12-31(13-15-32)11-5-4-6-20-19-30-25-9-7-22(29-2)18-24(20)25/h7-10,16-19,30H,3-6,11-15H2,1H3 |
| InChIKey | IKWSNUZEOSFJSN-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|