C22H26N6 — CID 140707348
3-[3-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]propyl]-5-isocyano-1H-indole (PubChem CID 140707348) has the molecular formula C22H26N6 and a molecular weight of 374.49 g/mol. Its IUPAC name is 3-[3-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]propyl]-5-isocyano-1H-indole.
| Compound Name | 3-[3-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]propyl]-5-isocyano-1H-indole |
|---|---|
| PubChem CID | 140707348 |
| Molecular Formula | C22H26N6 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 3-[3-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]propyl]-5-isocyano-1H-indole |
| SMILES | [C-]#[N+]c1ccc2[nH]cc(CCCN3CCN(c4nc(C)cc(C)n4)CC3)c2c1 |
| InChI | InChI=1S/C22H26N6/c1-16-13-17(2)26-22(25-16)28-11-9-27(10-12-28)8-4-5-18-15-24-21-7-6-19(23-3)14-20(18)21/h6-7,13-15,24H,4-5,8-12H2,1-2H3 |
| InChIKey | MJPXLLOGKFJMQJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 52.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|