C28H29N7O — CID 140880444
2-[2-[4-[4-(5-isocyano-1H-indol-3-yl)butyl]piperazin-1-yl]pyrimidin-5-yl]benzamide (PubChem CID 140880444) has the molecular formula C28H29N7O and a molecular weight of 479.59 g/mol. Its IUPAC name is 2-[2-[4-[4-(5-isocyano-1H-indol-3-yl)butyl]piperazin-1-yl]pyrimidin-5-yl]benzamide.
| Compound Name | 2-[2-[4-[4-(5-isocyano-1H-indol-3-yl)butyl]piperazin-1-yl]pyrimidin-5-yl]benzamide |
|---|---|
| PubChem CID | 140880444 |
| Molecular Formula | C28H29N7O |
| Molecular Weight | 479.59 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | 2-[2-[4-[4-(5-isocyano-1H-indol-3-yl)butyl]piperazin-1-yl]pyrimidin-5-yl]benzamide |
| SMILES | [C-]#[N+]c1ccc2[nH]cc(CCCCN3CCN(c4ncc(-c5ccccc5C(N)=O)cn4)CC3)c2c1 |
| InChI | InChI=1S/C28H29N7O/c1-30-22-9-10-26-25(16-22)20(17-31-26)6-4-5-11-34-12-14-35(15-13-34)28-32-18-21(19-33-28)23-7-2-3-8-24(23)27(29)36/h2-3,7-10,16-19,31H,4-6,11-15H2,(H2,29,36) |
| InChIKey | XLRRGKOVKGJYJI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.59 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|