C26H27F2N5 — CID 141464768
3-[4-[4-[5-(2,4-difluorophenyl)pyrimidin-2-yl]piperazin-1-yl]butyl]-1H-indole (PubChem CID 141464768) has the molecular formula C26H27F2N5 and a molecular weight of 447.53 g/mol. Its IUPAC name is 3-[4-[4-[5-(2,4-difluorophenyl)pyrimidin-2-yl]piperazin-1-yl]butyl]-1H-indole.
| Compound Name | 3-[4-[4-[5-(2,4-difluorophenyl)pyrimidin-2-yl]piperazin-1-yl]butyl]-1H-indole |
|---|---|
| PubChem CID | 141464768 |
| Molecular Formula | C26H27F2N5 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 3-[4-[4-[5-(2,4-difluorophenyl)pyrimidin-2-yl]piperazin-1-yl]butyl]-1H-indole |
| SMILES | Fc1ccc(-c2cnc(N3CCN(CCCCc4c[nH]c5ccccc45)CC3)nc2)c(F)c1 |
| InChI | InChI=1S/C26H27F2N5/c27-21-8-9-22(24(28)15-21)20-17-30-26(31-18-20)33-13-11-32(12-14-33)10-4-3-5-19-16-29-25-7-2-1-6-23(19)25/h1-2,6-9,15-18,29H,3-5,10-14H2 |
| InChIKey | NFROMPISQICTAW-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|