C29H28F2N6O — CID 140880447
N-[5-(2,4-difluorophenyl)-2-[4-[4-(5-isocyano-1H-indol-3-yl)butyl]piperazin-1-yl]-3-pyridinyl]formamide (PubChem CID 140880447) has the molecular formula C29H28F2N6O and a molecular weight of 514.58 g/mol. Its IUPAC name is N-[5-(2,4-difluorophenyl)-2-[4-[4-(5-isocyano-1H-indol-3-yl)butyl]piperazin-1-yl]-3-pyridinyl]formamide.
| Compound Name | N-[5-(2,4-difluorophenyl)-2-[4-[4-(5-isocyano-1H-indol-3-yl)butyl]piperazin-1-yl]-3-pyridinyl]formamide |
|---|---|
| PubChem CID | 140880447 |
| Molecular Formula | C29H28F2N6O |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | N-[5-(2,4-difluorophenyl)-2-[4-[4-(5-isocyano-1H-indol-3-yl)butyl]piperazin-1-yl]-3-pyridinyl]formamide |
| SMILES | [C-]#[N+]c1ccc2[nH]cc(CCCCN3CCN(c4ncc(-c5ccc(F)cc5F)cc4NC=O)CC3)c2c1 |
| InChI | InChI=1S/C29H28F2N6O/c1-32-23-6-8-27-25(16-23)20(17-33-27)4-2-3-9-36-10-12-37(13-11-36)29-28(35-19-38)14-21(18-34-29)24-7-5-22(30)15-26(24)31/h5-8,14-19,33H,2-4,9-13H2,(H,35,38) |
| InChIKey | JKVZMMMDWSGLJH-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|