C29H29FN6O — CID 135183167
3-[4-[4-[5-(4-fluorophenyl)-3-(nitrosomethyl)-2-pyridinyl]piperazin-1-yl]butyl]-1H-indole-5-carbonitrile (PubChem CID 135183167) has the molecular formula C29H29FN6O and a molecular weight of 496.59 g/mol. Its IUPAC name is 3-[4-[4-[5-(4-fluorophenyl)-3-(nitrosomethyl)-2-pyridinyl]piperazin-1-yl]butyl]-1H-indole-5-carbonitrile.
| Compound Name | 3-[4-[4-[5-(4-fluorophenyl)-3-(nitrosomethyl)-2-pyridinyl]piperazin-1-yl]butyl]-1H-indole-5-carbonitrile |
|---|---|
| PubChem CID | 135183167 |
| Molecular Formula | C29H29FN6O |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | 3-[4-[4-[5-(4-fluorophenyl)-3-(nitrosomethyl)-2-pyridinyl]piperazin-1-yl]butyl]-1H-indole-5-carbonitrile |
| SMILES | N#Cc1ccc2[nH]cc(CCCCN3CCN(c4ncc(-c5ccc(F)cc5)cc4CN=O)CC3)c2c1 |
| InChI | InChI=1S/C29H29FN6O/c30-26-7-5-22(6-8-26)24-16-25(20-34-37)29(33-19-24)36-13-11-35(12-14-36)10-2-1-3-23-18-32-28-9-4-21(17-31)15-27(23)28/h4-9,15-16,18-19,32H,1-3,10-14,20H2 |
| InChIKey | BEOGYPMVGIERDD-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|